C22H18F6N2O — CID 135079860
N-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[2-(methoxymethyl)prop-2-enyl]indol-3-yl]methanimine (PubChem CID 135079860) has the molecular formula C22H18F6N2O and a molecular weight of 440.39 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[2-(methoxymethyl)prop-2-enyl]indol-3-yl]methanimine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[2-(methoxymethyl)prop-2-enyl]indol-3-yl]methanimine |
|---|---|
| PubChem CID | 135079860 |
| Molecular Formula | C22H18F6N2O |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-[1-[2-(methoxymethyl)prop-2-enyl]indol-3-yl]methanimine |
| SMILES | C=C(COC)Cn1cc(/C=N/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C22H18F6N2O/c1-14(13-31-2)11-30-12-15(19-5-3-4-6-20(19)30)10-29-18-8-16(21(23,24)25)7-17(9-18)22(26,27)28/h3-10,12H,1,11,13H2,2H3/b29-10+ |
| InChIKey | IKPPAQHMYLFENN-VYVUJPJFSA-N |
| XLogP | 6.63 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|