C16H23NO2S2 — CID 135080135
tert-butyl N-[2-(1,3-dithian-2-yl)phenyl]-N-methylcarbamate (PubChem CID 135080135) has the molecular formula C16H23NO2S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is tert-butyl N-[2-(1,3-dithian-2-yl)phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(1,3-dithian-2-yl)phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 135080135 |
| Molecular Formula | C16H23NO2S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | tert-butyl N-[2-(1,3-dithian-2-yl)phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccccc1C1SCCCS1 |
| InChI | InChI=1S/C16H23NO2S2/c1-16(2,3)19-15(18)17(4)13-9-6-5-8-12(13)14-20-10-7-11-21-14/h5-6,8-9,14H,7,10-11H2,1-4H3 |
| InChIKey | VZMSFURIZQURJQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |