C16H23Cl2FN2O2 — CID 135082252
1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-4-methyldecan-2-one (PubChem CID 135082252) has the molecular formula C16H23Cl2FN2O2 and a molecular weight of 365.28 g/mol. Its IUPAC name is 1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-4-methyldecan-2-one.
| Compound Name | 1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-4-methyldecan-2-one |
|---|---|
| PubChem CID | 135082252 |
| Molecular Formula | C16H23Cl2FN2O2 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]-4-methyldecan-2-one |
| SMILES | CCCCCCC(C)CC(=O)COc1nc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C16H23Cl2FN2O2/c1-3-4-5-6-7-10(2)8-11(22)9-23-16-13(18)14(20)12(17)15(19)21-16/h10H,3-9H2,1-2H3,(H2,20,21) |
| InChIKey | GSRXLIAEXZJHFW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|