C15H21Cl2FN2O4 — CID 15278322
1-butoxybutan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 15278322) has the molecular formula C15H21Cl2FN2O4 and a molecular weight of 383.25 g/mol. Its IUPAC name is 1-butoxybutan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | 1-butoxybutan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 15278322 |
| Molecular Formula | C15H21Cl2FN2O4 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 1-butoxybutan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | CCCCOCC(CC)OC(=O)COc1nc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C15H21Cl2FN2O4/c1-3-5-6-22-7-9(4-2)24-10(21)8-23-15-12(17)13(19)11(16)14(18)20-15/h9H,3-8H2,1-2H3,(H2,19,20) |
| InChIKey | QDAXJCZLBFKOQS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|