C14H19Cl2FN2O5 — CID 15278323
1-(1-methoxypropan-2-yloxy)propan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate (PubChem CID 15278323) has the molecular formula C14H19Cl2FN2O5 and a molecular weight of 385.22 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yloxy)propan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate.
| Compound Name | 1-(1-methoxypropan-2-yloxy)propan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 15278323 |
| Molecular Formula | C14H19Cl2FN2O5 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(1-methoxypropan-2-yloxy)propan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate |
| SMILES | COCC(C)OCC(C)OC(=O)COc1nc(F)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C14H19Cl2FN2O5/c1-7(4-21-3)22-5-8(2)24-9(20)6-23-14-11(16)12(18)10(15)13(17)19-14/h7-8H,4-6H2,1-3H3,(H2,18,19) |
| InChIKey | HMNRWORRTOJWTD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|