C16H34ClO2P — CID 135082549
tributyl-chloro-(1,3-dioxolan-2-ylmethyl)-λ5-phosphane (PubChem CID 135082549) has the molecular formula C16H34ClO2P and a molecular weight of 324.87 g/mol. Its IUPAC name is tributyl-chloro-(1,3-dioxolan-2-ylmethyl)-λ5-phosphane.
| Compound Name | tributyl-chloro-(1,3-dioxolan-2-ylmethyl)-λ5-phosphane |
|---|---|
| PubChem CID | 135082549 |
| Molecular Formula | C16H34ClO2P |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tributyl-chloro-(1,3-dioxolan-2-ylmethyl)-λ5-phosphane |
| SMILES | CCCCP(Cl)(CCCC)(CCCC)CC1OCCO1 |
| InChI | InChI=1S/C16H34ClO2P/c1-4-7-12-20(17,13-8-5-2,14-9-6-3)15-16-18-10-11-19-16/h16H,4-15H2,1-3H3 |
| InChIKey | HRXRCTRVPYJSPQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|