About gold(1+);nitrobenzene;1,10-phenanthroline
gold(1+);nitrobenzene;1,10-phenanthroline (PubChem CID 135082789) has the molecular formula C18H12AuN3O2
and a molecular weight of 499.28 g/mol. Its IUPAC name is gold(1+);nitrobenzene;1,10-phenanthroline.
Molecular Properties
| Compound Name | gold(1+);nitrobenzene;1,10-phenanthroline |
| PubChem CID | 135082789 |
| Molecular Formula | C18H12AuN3O2 |
| Molecular Weight | 499.28 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | gold(1+);nitrobenzene;1,10-phenanthroline |
| SMILES | O=[N+]([O-])c1[c-]cccc1.[Au+].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C6H4NO2.Au/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-7(9)6-4-2-1-3-5-6;/h1-8H;1-4H;/q;-1;+1 |
| InChIKey | DMJLGVNCRXLESK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);nitrobenzene;1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);nitrobenzene;1,10-phenanthroline?
The IUPAC name of gold(1+);nitrobenzene;1,10-phenanthroline (CID 135082789) is gold(1+);nitrobenzene;1,10-phenanthroline.
What is the SMILES notation for gold(1+);nitrobenzene;1,10-phenanthroline?
The canonical SMILES for gold(1+);nitrobenzene;1,10-phenanthroline is O=[N+]([O-])c1[c-]cccc1.[Au+].c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of gold(1+);nitrobenzene;1,10-phenanthroline?
The InChIKey is DMJLGVNCRXLESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C6H4NO2.Au/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;8-7(9)6-4-2-1-3-5-6;/h1-8H;1-4H;/q;-1;+1.
What are the key properties of gold(1+);nitrobenzene;1,10-phenanthroline?
gold(1+);nitrobenzene;1,10-phenanthroline has a molecular weight of 499.28 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);nitrobenzene;1,10-phenanthroline is sourced from PubChem (CID 135082789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).