About bromobenzene;nitrobenzene;yttrium
bromobenzene;nitrobenzene;yttrium (PubChem CID 134852168) has the molecular formula C12H8BrNO2Y-2
and a molecular weight of 367.01 g/mol. Its IUPAC name is bromobenzene;nitrobenzene;yttrium.
Molecular Properties
| Compound Name | bromobenzene;nitrobenzene;yttrium |
| PubChem CID | 134852168 |
| Molecular Formula | C12H8BrNO2Y-2 |
| Molecular Weight | 367.01 g/mol |
| Exact Mass | 365.88 |
| IUPAC Name | bromobenzene;nitrobenzene;yttrium |
| SMILES | Brc1[c-]cccc1.O=[N+]([O-])c1[c-]cccc1.[Y] |
| InChI | InChI=1S/C6H4Br.C6H4NO2.Y/c7-6-4-2-1-3-5-6;8-7(9)6-4-2-1-3-5-6;/h1-4H;1-4H;/q2*-1; |
| InChIKey | XHFNNSHWFMWBON-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.01 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;nitrobenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;nitrobenzene;yttrium?
The IUPAC name of bromobenzene;nitrobenzene;yttrium (CID 134852168) is bromobenzene;nitrobenzene;yttrium.
What is the SMILES notation for bromobenzene;nitrobenzene;yttrium?
The canonical SMILES for bromobenzene;nitrobenzene;yttrium is Brc1[c-]cccc1.O=[N+]([O-])c1[c-]cccc1.[Y].
What is the InChIKey of bromobenzene;nitrobenzene;yttrium?
The InChIKey is XHFNNSHWFMWBON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br.C6H4NO2.Y/c7-6-4-2-1-3-5-6;8-7(9)6-4-2-1-3-5-6;/h1-4H;1-4H;/q2*-1;.
What are the key properties of bromobenzene;nitrobenzene;yttrium?
bromobenzene;nitrobenzene;yttrium has a molecular weight of 367.01 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;nitrobenzene;yttrium is sourced from PubChem (CID 134852168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).