C15H12AgF3N2O3S — CID 135085487
silver;2,9-dimethyl-1,10-phenanthroline;trifluoromethanesulfonate (PubChem CID 135085487) has the molecular formula C15H12AgF3N2O3S and a molecular weight of 465.20 g/mol. Its IUPAC name is silver;2,9-dimethyl-1,10-phenanthroline;trifluoromethanesulfonate.
| Compound Name | silver;2,9-dimethyl-1,10-phenanthroline;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135085487 |
| Molecular Formula | C15H12AgF3N2O3S |
| Molecular Weight | 465.20 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | silver;2,9-dimethyl-1,10-phenanthroline;trifluoromethanesulfonate |
| SMILES | Cc1ccc2ccc3ccc(C)nc3c2n1.O=S(=O)([O-])C(F)(F)F.[Ag+] |
| InChI | InChI=1S/C14H12N2.CHF3O3S.Ag/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;2-1(3,4)8(5,6)7;/h3-8H,1-2H3;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | NEJQTUPUOHZLCJ-UHFFFAOYSA-M |
| XLogP | 3.45 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|