C31H34FN3O7S — CID 135089830
14-[3-(benzenesulfonyl)propanoyl]-5-fluoro-22-methoxy-2-oxa-9,14,18-triazatricyclo[18.2.2.13,7]pentacosa-1(22),3,5,7(25),20,23-hexaene-10,19-dione (PubChem CID 135089830) has the molecular formula C31H34FN3O7S and a molecular weight of 611.69 g/mol. Its IUPAC name is 14-[3-(benzenesulfonyl)propanoyl]-5-fluoro-22-methoxy-2-oxa-9,14,18-triazatricyclo[18.2.2.13,7]pentacosa-1(22),3,5,7(25),20,23-hexaene-10,19-dione.
| Compound Name | 14-[3-(benzenesulfonyl)propanoyl]-5-fluoro-22-methoxy-2-oxa-9,14,18-triazatricyclo[18.2.2.13,7]pentacosa-1(22),3,5,7(25),20,23-hexaene-10,19-dione |
|---|---|
| PubChem CID | 135089830 |
| Molecular Formula | C31H34FN3O7S |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 14-[3-(benzenesulfonyl)propanoyl]-5-fluoro-22-methoxy-2-oxa-9,14,18-triazatricyclo[18.2.2.13,7]pentacosa-1(22),3,5,7(25),20,23-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1Oc1cc(F)cc(c1)CNC(=O)CCCN(C(=O)CCS(=O)(=O)c1ccccc1)CCCNC2=O |
| InChI | InChI=1S/C31H34FN3O7S/c1-41-28-19-23-10-11-27(28)42-25-18-22(17-24(32)20-25)21-34-29(36)9-5-14-35(15-6-13-33-31(23)38)30(37)12-16-43(39,40)26-7-3-2-4-8-26/h2-4,7-8,10-11,17-20H,5-6,9,12-16,21H2,1H3,(H,33,38)(H,34,36) |
| InChIKey | YKAQWTUMZVGPBC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |