C30H39FN4O6 — CID 131901278
(6S)-13-[3-(4-fluorophenyl)propanoyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione (PubChem CID 131901278) has the molecular formula C30H39FN4O6 and a molecular weight of 570.66 g/mol. Its IUPAC name is (6S)-13-[3-(4-fluorophenyl)propanoyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione.
| Compound Name | (6S)-13-[3-(4-fluorophenyl)propanoyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131901278 |
| Molecular Formula | C30H39FN4O6 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | (6S)-13-[3-(4-fluorophenyl)propanoyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H](C)C(=O)N(C)CCCCN(C(=O)CCc1ccc(F)cc1)CCCNC2=O |
| InChI | InChI=1S/C30H39FN4O6/c1-21-30(39)34(2)16-4-5-17-35(28(37)14-9-22-7-11-24(31)12-8-22)18-6-15-32-29(38)23-10-13-25(26(19-23)40-3)41-20-27(36)33-21/h7-8,10-13,19,21H,4-6,9,14-18,20H2,1-3H3,(H,32,38)(H,33,36)/t21-/m0/s1 |
| InChIKey | USJPNSICRZAKOO-NRFANRHFSA-N |
| XLogP | 2.55 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|