C29H41N5O5S — CID 131952061
(6S)-21-methoxy-6,8-dimethyl-13-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione (PubChem CID 131952061) has the molecular formula C29H41N5O5S and a molecular weight of 571.74 g/mol. Its IUPAC name is (6S)-21-methoxy-6,8-dimethyl-13-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione.
| Compound Name | (6S)-21-methoxy-6,8-dimethyl-13-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131952061 |
| Molecular Formula | C29H41N5O5S |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (6S)-21-methoxy-6,8-dimethyl-13-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H](C)C(=O)N(C)CCCCN(Cc1nc3c(s1)CCCC3)CCCNC2=O |
| InChI | InChI=1S/C29H41N5O5S/c1-20-29(37)33(2)14-6-7-15-34(18-27-32-22-9-4-5-10-25(22)40-27)16-8-13-30-28(36)21-11-12-23(24(17-21)38-3)39-19-26(35)31-20/h11-12,17,20H,4-10,13-16,18-19H2,1-3H3,(H,30,36)(H,31,35)/t20-/m0/s1 |
| InChIKey | ZBWBSWSBZSTDHY-FQEVSTJZSA-N |
| XLogP | 2.79 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|