C26H38N4O7 — CID 131934619
(6S)-21-methoxy-6,8-dimethyl-13-[(2R)-oxolane-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione (PubChem CID 131934619) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is (6S)-21-methoxy-6,8-dimethyl-13-[(2R)-oxolane-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione.
| Compound Name | (6S)-21-methoxy-6,8-dimethyl-13-[(2R)-oxolane-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131934619 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (6S)-21-methoxy-6,8-dimethyl-13-[(2R)-oxolane-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H](C)C(=O)N(C)CCCCN(C(=O)[C@H]1CCCO1)CCCNC2=O |
| InChI | InChI=1S/C26H38N4O7/c1-18-25(33)29(2)12-4-5-13-30(26(34)21-8-6-15-36-21)14-7-11-27-24(32)19-9-10-20(22(16-19)35-3)37-17-23(31)28-18/h9-10,16,18,21H,4-8,11-15,17H2,1-3H3,(H,27,32)(H,28,31)/t18-,21+/m0/s1 |
| InChIKey | RXGMGNFTBLJWLC-GHTZIAJQSA-N |
| XLogP | 0.96 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|