C33H42N6O6 — CID 131929142
(6S)-13-[2-(2-cyclopropylbenzimidazol-1-yl)acetyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione (PubChem CID 131929142) has the molecular formula C33H42N6O6 and a molecular weight of 618.74 g/mol. Its IUPAC name is (6S)-13-[2-(2-cyclopropylbenzimidazol-1-yl)acetyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione.
| Compound Name | (6S)-13-[2-(2-cyclopropylbenzimidazol-1-yl)acetyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131929142 |
| Molecular Formula | C33H42N6O6 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | (6S)-13-[2-(2-cyclopropylbenzimidazol-1-yl)acetyl]-21-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[17.2.2]tricosa-1(21),19,22-triene-4,7,18-trione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H](C)C(=O)N(C)CCCCN(C(=O)Cn1c(C3CC3)nc3ccccc31)CCCNC2=O |
| InChI | InChI=1S/C33H42N6O6/c1-22-33(43)37(2)16-6-7-17-38(30(41)20-39-26-10-5-4-9-25(26)36-31(39)23-11-12-23)18-8-15-34-32(42)24-13-14-27(28(19-24)44-3)45-21-29(40)35-22/h4-5,9-10,13-14,19,22-23H,6-8,11-12,15-18,20-21H2,1-3H3,(H,34,42)(H,35,40)/t22-/m0/s1 |
| InChIKey | CKIYIIRKROPNNF-QFIPXVFZSA-N |
| XLogP | 2.71 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|