C29H45N5O6 — CID 131941893
(6S)-24-methoxy-6,8-dimethyl-13-[(2S)-piperidine-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione (PubChem CID 131941893) has the molecular formula C29H45N5O6 and a molecular weight of 559.71 g/mol. Its IUPAC name is (6S)-24-methoxy-6,8-dimethyl-13-[(2S)-piperidine-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione.
| Compound Name | (6S)-24-methoxy-6,8-dimethyl-13-[(2S)-piperidine-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131941893 |
| Molecular Formula | C29H45N5O6 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | (6S)-24-methoxy-6,8-dimethyl-13-[(2S)-piperidine-2-carbonyl]-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione |
| SMILES | COc1ccc2cc1OCC(=O)N[C@@H](C)C(=O)N(C)CCCCN(C(=O)[C@@H]1CCCCN1)CCCNC(=O)CC2 |
| InChI | InChI=1S/C29H45N5O6/c1-21-28(37)33(2)16-6-7-17-34(29(38)23-9-4-5-14-30-23)18-8-15-31-26(35)13-11-22-10-12-24(39-3)25(19-22)40-20-27(36)32-21/h10,12,19,21,23,30H,4-9,11,13-18,20H2,1-3H3,(H,31,35)(H,32,36)/t21-,23-/m0/s1 |
| InChIKey | GTRYTAQXNMAMIN-GMAHTHKFSA-N |
| XLogP | 1.24 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |