C31H40N6O6S — CID 131918264
(6S)-24-methoxy-6,8-dimethyl-13-(3-thiophen-3-yl-1H-pyrazole-5-carbonyl)-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione (PubChem CID 131918264) has the molecular formula C31H40N6O6S and a molecular weight of 624.76 g/mol. Its IUPAC name is (6S)-24-methoxy-6,8-dimethyl-13-(3-thiophen-3-yl-1H-pyrazole-5-carbonyl)-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione.
| Compound Name | (6S)-24-methoxy-6,8-dimethyl-13-(3-thiophen-3-yl-1H-pyrazole-5-carbonyl)-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131918264 |
| Molecular Formula | C31H40N6O6S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | (6S)-24-methoxy-6,8-dimethyl-13-(3-thiophen-3-yl-1H-pyrazole-5-carbonyl)-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione |
| SMILES | COc1ccc2cc1OCC(=O)N[C@@H](C)C(=O)N(C)CCCCN(C(=O)c1cc(-c3ccsc3)n[nH]1)CCCNC(=O)CC2 |
| InChI | InChI=1S/C31H40N6O6S/c1-21-30(40)36(2)13-4-5-14-37(31(41)25-18-24(34-35-25)23-11-16-44-20-23)15-6-12-32-28(38)10-8-22-7-9-26(42-3)27(17-22)43-19-29(39)33-21/h7,9,11,16-18,20-21H,4-6,8,10,12-15,19H2,1-3H3,(H,32,38)(H,33,39)(H,34,35)/t21-/m0/s1 |
| InChIKey | RRTUTVPEQITFTJ-NRFANRHFSA-N |
| XLogP | 2.86 |
| TPSA | 145.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |