C30H48N4O5 — CID 131938111
(6S)-13-(2,2-dimethylpent-4-enyl)-24-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione (PubChem CID 131938111) has the molecular formula C30H48N4O5 and a molecular weight of 544.74 g/mol. Its IUPAC name is (6S)-13-(2,2-dimethylpent-4-enyl)-24-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione.
| Compound Name | (6S)-13-(2,2-dimethylpent-4-enyl)-24-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione |
|---|---|
| PubChem CID | 131938111 |
| Molecular Formula | C30H48N4O5 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | (6S)-13-(2,2-dimethylpent-4-enyl)-24-methoxy-6,8-dimethyl-2-oxa-5,8,13,17-tetrazabicyclo[19.3.1]pentacosa-1(24),21(25),22-triene-4,7,18-trione |
| SMILES | C=CCC(C)(C)CN1CCCCN(C)C(=O)[C@H](C)NC(=O)COc2cc(ccc2OC)CCC(=O)NCCC1 |
| InChI | InChI=1S/C30H48N4O5/c1-7-15-30(3,4)22-34-18-9-8-17-33(5)29(37)23(2)32-28(36)21-39-26-20-24(11-13-25(26)38-6)12-14-27(35)31-16-10-19-34/h7,11,13,20,23H,1,8-10,12,14-19,21-22H2,2-6H3,(H,31,35)(H,32,36)/t23-/m0/s1 |
| InChIKey | LOGUMNGIYLAXBF-QHCPKHFHSA-N |
| XLogP | 3.17 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|