C29H32N4O5 — CID 138387193
(3S,7S)-15-methoxy-5-(pyridin-4-ylmethyl)-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione (PubChem CID 138387193) has the molecular formula C29H32N4O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is (3S,7S)-15-methoxy-5-(pyridin-4-ylmethyl)-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione.
| Compound Name | (3S,7S)-15-methoxy-5-(pyridin-4-ylmethyl)-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione |
|---|---|
| PubChem CID | 138387193 |
| Molecular Formula | C29H32N4O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (3S,7S)-15-methoxy-5-(pyridin-4-ylmethyl)-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@H]1CN(Cc3ccncc3)C[C@@H]1NC(=O)CC2 |
| InChI | InChI=1S/C29H32N4O5/c1-36-25-8-4-20-5-9-28(34)32-24-17-33(16-22-10-12-30-13-11-22)18-27(24)38-23-6-2-21(3-7-23)15-31-29(35)19-37-26(25)14-20/h2-4,6-8,10-14,24,27H,5,9,15-19H2,1H3,(H,31,35)(H,32,34)/t24-,27-/m0/s1 |
| InChIKey | CGTJOARXFMFZEP-IGKIAQTJSA-N |
| XLogP | 2.48 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |