C26H33N3O6 — CID 171385300
(3R,8R)-6-(2-hydroxyethyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione (PubChem CID 171385300) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is (3R,8R)-6-(2-hydroxyethyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione.
| Compound Name | (3R,8R)-6-(2-hydroxyethyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
|---|---|
| PubChem CID | 171385300 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (3R,8R)-6-(2-hydroxyethyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(CCO)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2 |
| InChI | InChI=1S/C26H33N3O6/c1-33-24-14-18-4-8-23(24)34-17-26(32)28-21-16-29(12-13-30)11-10-22(21)35-20-6-2-19(3-7-20)15-27-25(31)9-5-18/h2-4,6-8,14,21-22,30H,5,9-13,15-17H2,1H3,(H,27,31)(H,28,32)/t21-,22-/m1/s1 |
| InChIKey | HDKAWEDKWDSXEE-FGZHOGPDSA-N |
| XLogP | 1.27 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |