C33H35F2N3O6 — CID 170508098
(3R,8R)-6-[3-(3,4-difluorophenyl)propanoyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione (PubChem CID 170508098) has the molecular formula C33H35F2N3O6 and a molecular weight of 607.65 g/mol. Its IUPAC name is (3R,8R)-6-[3-(3,4-difluorophenyl)propanoyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione.
| Compound Name | (3R,8R)-6-[3-(3,4-difluorophenyl)propanoyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
|---|---|
| PubChem CID | 170508098 |
| Molecular Formula | C33H35F2N3O6 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | (3R,8R)-6-[3-(3,4-difluorophenyl)propanoyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(C(=O)CCc3ccc(F)c(F)c3)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2 |
| InChI | InChI=1S/C33H35F2N3O6/c1-42-30-17-22-5-11-29(30)43-20-32(40)37-27-19-38(33(41)13-7-21-4-10-25(34)26(35)16-21)15-14-28(27)44-24-8-2-23(3-9-24)18-36-31(39)12-6-22/h2-5,8-11,16-17,27-28H,6-7,12-15,18-20H2,1H3,(H,36,39)(H,37,40)/t27-,28-/m1/s1 |
| InChIKey | OAKASGJYJPKITH-VSGBNLITSA-N |
| XLogP | 3.71 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |