C29H37N3O5 — CID 170511968
(3R,8R)-14-methoxy-6-(3-methylbut-2-enyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione (PubChem CID 170511968) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is (3R,8R)-14-methoxy-6-(3-methylbut-2-enyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione.
| Compound Name | (3R,8R)-14-methoxy-6-(3-methylbut-2-enyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
|---|---|
| PubChem CID | 170511968 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (3R,8R)-14-methoxy-6-(3-methylbut-2-enyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(CC=C(C)C)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2 |
| InChI | InChI=1S/C29H37N3O5/c1-20(2)12-14-32-15-13-25-24(18-32)31-29(34)19-36-26-10-6-21(16-27(26)35-3)7-11-28(33)30-17-22-4-8-23(37-25)9-5-22/h4-6,8-10,12,16,24-25H,7,11,13-15,17-19H2,1-3H3,(H,30,33)(H,31,34)/t24-,25-/m1/s1 |
| InChIKey | XDIPCCOUDHUTBY-JWQCQUIFSA-N |
| XLogP | 3.24 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|