C33H38N4O9 — CID 171707276
(3R,8R)-6-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione;formic acid (PubChem CID 171707276) has the molecular formula C33H38N4O9 and a molecular weight of 634.69 g/mol. Its IUPAC name is (3R,8R)-6-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione;formic acid.
| Compound Name | (3R,8R)-6-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione;formic acid |
|---|---|
| PubChem CID | 171707276 |
| Molecular Formula | C33H38N4O9 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | (3R,8R)-6-(4,6-dimethyl-2-oxo-1H-pyridine-3-carbonyl)-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione;formic acid |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(C(=O)c3c(C)cc(C)[nH]c3=O)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2.O=CO |
| InChI | InChI=1S/C32H36N4O7.CH2O2/c1-19-14-20(2)34-31(39)30(19)32(40)36-13-12-25-24(17-36)35-29(38)18-42-26-10-6-21(15-27(26)41-3)7-11-28(37)33-16-22-4-8-23(43-25)9-5-22;2-1-3/h4-6,8-10,14-15,24-25H,7,11-13,16-18H2,1-3H3,(H,33,37)(H,34,39)(H,35,38);1H,(H,2,3)/t24-,25-;/m1./s1 |
| InChIKey | LEEOIXYHESWKTQ-JIMLSGQQSA-N |
| XLogP | 2.12 |
| TPSA | 176.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|