C31H36N4O7 — CID 171712429
formic acid;(3R,8R)-14-methoxy-6-(pyridin-2-ylmethyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione (PubChem CID 171712429) has the molecular formula C31H36N4O7 and a molecular weight of 576.65 g/mol. Its IUPAC name is formic acid;(3R,8R)-14-methoxy-6-(pyridin-2-ylmethyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione.
| Compound Name | formic acid;(3R,8R)-14-methoxy-6-(pyridin-2-ylmethyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
|---|---|
| PubChem CID | 171712429 |
| Molecular Formula | C31H36N4O7 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | formic acid;(3R,8R)-14-methoxy-6-(pyridin-2-ylmethyl)-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(Cc3ccccn3)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2.O=CO |
| InChI | InChI=1S/C30H34N4O5.CH2O2/c1-37-28-16-21-7-11-27(28)38-20-30(36)33-25-19-34(18-23-4-2-3-14-31-23)15-13-26(25)39-24-9-5-22(6-10-24)17-32-29(35)12-8-21;2-1-3/h2-7,9-11,14,16,25-26H,8,12-13,15,17-20H2,1H3,(H,32,35)(H,33,36);1H,(H,2,3)/t25-,26-;/m1./s1 |
| InChIKey | JDFMVANMMCEFHE-JUJAXGASSA-N |
| XLogP | 2.57 |
| TPSA | 139.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|