C32H37N3O5 — CID 171389471
(3R,8R)-14-methoxy-6-[(3-methylphenyl)methyl]-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione (PubChem CID 171389471) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is (3R,8R)-14-methoxy-6-[(3-methylphenyl)methyl]-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione.
| Compound Name | (3R,8R)-14-methoxy-6-[(3-methylphenyl)methyl]-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
|---|---|
| PubChem CID | 171389471 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | (3R,8R)-14-methoxy-6-[(3-methylphenyl)methyl]-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(Cc3cccc(C)c3)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2 |
| InChI | InChI=1S/C32H37N3O5/c1-22-4-3-5-25(16-22)19-35-15-14-28-27(20-35)34-32(37)21-39-29-12-8-23(17-30(29)38-2)9-13-31(36)33-18-24-6-10-26(40-28)11-7-24/h3-8,10-12,16-17,27-28H,9,13-15,18-21H2,1-2H3,(H,33,36)(H,34,37)/t27-,28-/m1/s1 |
| InChIKey | AQVNMRIGUQCGTE-VSGBNLITSA-N |
| XLogP | 3.78 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |