C31H35N3O6S — CID 171386600
(3R,8R)-6-[(5-acetylthiophen-3-yl)methyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione (PubChem CID 171386600) has the molecular formula C31H35N3O6S and a molecular weight of 577.70 g/mol. Its IUPAC name is (3R,8R)-6-[(5-acetylthiophen-3-yl)methyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione.
| Compound Name | (3R,8R)-6-[(5-acetylthiophen-3-yl)methyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
|---|---|
| PubChem CID | 171386600 |
| Molecular Formula | C31H35N3O6S |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (3R,8R)-6-[(5-acetylthiophen-3-yl)methyl]-14-methoxy-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaene-10,19-dione |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(Cc3csc(C(C)=O)c3)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2 |
| InChI | InChI=1S/C31H35N3O6S/c1-20(35)29-14-23(19-41-29)16-34-12-11-26-25(17-34)33-31(37)18-39-27-9-5-21(13-28(27)38-2)6-10-30(36)32-15-22-3-7-24(40-26)8-4-22/h3-5,7-9,13-14,19,25-26H,6,10-12,15-18H2,1-2H3,(H,32,36)(H,33,37)/t25-,26-/m1/s1 |
| InChIKey | VSRILKNZGWAQEL-CLJLJLNGSA-N |
| XLogP | 3.74 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |