C28H33N3O6 — CID 137343168
(3S,7S)-5-(cyclobutanecarbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione (PubChem CID 137343168) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is (3S,7S)-5-(cyclobutanecarbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione.
| Compound Name | (3S,7S)-5-(cyclobutanecarbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione |
|---|---|
| PubChem CID | 137343168 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | (3S,7S)-5-(cyclobutanecarbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione |
| SMILES | COc1cc2ccc1OCC(=O)NCc1ccc(cc1)O[C@H]1CN(C(=O)C3CCC3)C[C@@H]1NC(=O)CC2 |
| InChI | InChI=1S/C28H33N3O6/c1-35-24-13-18-7-11-23(24)36-17-27(33)29-14-19-5-9-21(10-6-19)37-25-16-31(28(34)20-3-2-4-20)15-22(25)30-26(32)12-8-18/h5-7,9-11,13,20,22,25H,2-4,8,12,14-17H2,1H3,(H,29,33)(H,30,32)/t22-,25-/m0/s1 |
| InChIKey | JRYQSOHOVXFDJI-DHLKQENFSA-N |
| XLogP | 2.21 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |