C25H29N3O6 — CID 137343241
(3S,7S)-5-acetyl-15-methoxy-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione (PubChem CID 137343241) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is (3S,7S)-5-acetyl-15-methoxy-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione.
| Compound Name | (3S,7S)-5-acetyl-15-methoxy-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione |
|---|---|
| PubChem CID | 137343241 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (3S,7S)-5-acetyl-15-methoxy-2,17-dioxa-5,8,20-triazatetracyclo[20.2.2.112,16.03,7]heptacosa-1(25),12(27),13,15,22(26),23-hexaene-9,19-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@H]1CN(C(C)=O)C[C@@H]1NC(=O)CC2 |
| InChI | InChI=1S/C25H29N3O6/c1-16(29)28-13-20-23(14-28)34-19-7-3-18(4-8-19)12-26-25(31)15-33-22-11-17(5-9-21(22)32-2)6-10-24(30)27-20/h3-5,7-9,11,20,23H,6,10,12-15H2,1-2H3,(H,26,31)(H,27,30)/t20-,23-/m0/s1 |
| InChIKey | MOSUTMHTYNXYGR-REWPJTCUSA-N |
| XLogP | 1.43 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |