C31H31N5O6 — CID 137343378
(3S,7S)-5-(3H-benzimidazole-5-carbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione (PubChem CID 137343378) has the molecular formula C31H31N5O6 and a molecular weight of 569.62 g/mol. Its IUPAC name is (3S,7S)-5-(3H-benzimidazole-5-carbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione.
| Compound Name | (3S,7S)-5-(3H-benzimidazole-5-carbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione |
|---|---|
| PubChem CID | 137343378 |
| Molecular Formula | C31H31N5O6 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | (3S,7S)-5-(3H-benzimidazole-5-carbonyl)-14-methoxy-2,16-dioxa-5,8,19-triazatetracyclo[19.2.2.212,15.03,7]heptacosa-1(24),12,14,21(25),22,26-hexaene-9,18-dione |
| SMILES | COc1cc2ccc1OCC(=O)NCc1ccc(cc1)O[C@H]1CN(C(=O)c3ccc4nc[nH]c4c3)C[C@@H]1NC(=O)CC2 |
| InChI | InChI=1S/C31H31N5O6/c1-40-27-12-19-4-10-26(27)41-17-30(38)32-14-20-2-7-22(8-3-20)42-28-16-36(15-25(28)35-29(37)11-5-19)31(39)21-6-9-23-24(13-21)34-18-33-23/h2-4,6-10,12-13,18,25,28H,5,11,14-17H2,1H3,(H,32,38)(H,33,34)(H,35,37)/t25-,28-/m0/s1 |
| InChIKey | BOTMKIVADRVRFA-LSYYVWMOSA-N |
| XLogP | 2.60 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |