C26H32N4O6 — CID 171386485
2-[(3R,8R)-14-methoxy-10,19-dioxo-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaen-6-yl]acetamide (PubChem CID 171386485) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-[(3R,8R)-14-methoxy-10,19-dioxo-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaen-6-yl]acetamide.
| Compound Name | 2-[(3R,8R)-14-methoxy-10,19-dioxo-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaen-6-yl]acetamide |
|---|---|
| PubChem CID | 171386485 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 2-[(3R,8R)-14-methoxy-10,19-dioxo-2,12-dioxa-6,9,20-triazatetracyclo[20.2.2.213,16.03,8]octacosa-1(25),13,15,22(26),23,27-hexaen-6-yl]acetamide |
| SMILES | COc1cc2ccc1OCC(=O)N[C@@H]1CN(CC(N)=O)CC[C@H]1Oc1ccc(cc1)CNC(=O)CC2 |
| InChI | InChI=1S/C26H32N4O6/c1-34-23-12-17-4-8-22(23)35-16-26(33)29-20-14-30(15-24(27)31)11-10-21(20)36-19-6-2-18(3-7-19)13-28-25(32)9-5-17/h2-4,6-8,12,20-21H,5,9-11,13-16H2,1H3,(H2,27,31)(H,28,32)(H,29,33)/t20-,21-/m1/s1 |
| InChIKey | HUPYXLDJLAMUNG-NHCUHLMSSA-N |
| XLogP | 0.76 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |