C29H34F2N6O7 — CID 154822408
(4S,10R)-16-(3,5-difluoropyridine-2-carbonyl)-24-methoxy-4-methyl-22-oxa-3,6,12,16,19-pentazatricyclo[21.2.2.06,10]heptacosa-1(25),23,26-triene-2,5,11,18-tetrone (PubChem CID 154822408) has the molecular formula C29H34F2N6O7 and a molecular weight of 616.62 g/mol. Its IUPAC name is (4S,10R)-16-(3,5-difluoropyridine-2-carbonyl)-24-methoxy-4-methyl-22-oxa-3,6,12,16,19-pentazatricyclo[21.2.2.06,10]heptacosa-1(25),23,26-triene-2,5,11,18-tetrone.
| Compound Name | (4S,10R)-16-(3,5-difluoropyridine-2-carbonyl)-24-methoxy-4-methyl-22-oxa-3,6,12,16,19-pentazatricyclo[21.2.2.06,10]heptacosa-1(25),23,26-triene-2,5,11,18-tetrone |
|---|---|
| PubChem CID | 154822408 |
| Molecular Formula | C29H34F2N6O7 |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | (4S,10R)-16-(3,5-difluoropyridine-2-carbonyl)-24-methoxy-4-methyl-22-oxa-3,6,12,16,19-pentazatricyclo[21.2.2.06,10]heptacosa-1(25),23,26-triene-2,5,11,18-tetrone |
| SMILES | COc1cc2ccc1OCCNC(=O)CN(C(=O)c1ncc(F)cc1F)CCCNC(=O)[C@H]1CCCN1C(=O)[C@H](C)NC2=O |
| InChI | InChI=1S/C29H34F2N6O7/c1-17-28(41)37-11-3-5-21(37)27(40)33-8-4-10-36(29(42)25-20(31)14-19(30)15-34-25)16-24(38)32-9-12-44-22-7-6-18(26(39)35-17)13-23(22)43-2/h6-7,13-15,17,21H,3-5,8-12,16H2,1-2H3,(H,32,38)(H,33,40)(H,35,39)/t17-,21+/m0/s1 |
| InChIKey | JDHHECIVJZTAQK-LAUBAEHRSA-N |
| XLogP | 0.63 |
| TPSA | 159.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|