C18H30N2O3 — CID 135091481
3-[2-(oxolan-3-yl)ethyl]-11-prop-2-enyl-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one (PubChem CID 135091481) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-[2-(oxolan-3-yl)ethyl]-11-prop-2-enyl-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one.
| Compound Name | 3-[2-(oxolan-3-yl)ethyl]-11-prop-2-enyl-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one |
|---|---|
| PubChem CID | 135091481 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 3-[2-(oxolan-3-yl)ethyl]-11-prop-2-enyl-7-oxa-3,11-diazaspiro[5.6]dodecan-10-one |
| SMILES | C=CCN1CC2(CCN(CCC3CCOC3)CC2)OCCC1=O |
| InChI | InChI=1S/C18H30N2O3/c1-2-8-20-15-18(23-13-5-17(20)21)6-10-19(11-7-18)9-3-16-4-12-22-14-16/h2,16H,1,3-15H2 |
| InChIKey | BTMONKGUTZRRAH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|