C17H30N2OS — CID 72939168
9-(3-methylsulfanylbutyl)-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72939168) has the molecular formula C17H30N2OS and a molecular weight of 310.51 g/mol. Its IUPAC name is 9-(3-methylsulfanylbutyl)-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-(3-methylsulfanylbutyl)-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72939168 |
| Molecular Formula | C17H30N2OS |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 9-(3-methylsulfanylbutyl)-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=CCN1CC2(CCC1=O)CCN(CCC(C)SC)CC2 |
| InChI | InChI=1S/C17H30N2OS/c1-4-10-19-14-17(7-5-16(19)20)8-12-18(13-9-17)11-6-15(2)21-3/h4,15H,1,5-14H2,2-3H3 |
| InChIKey | OIXQGGJLWBJSFQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|