C16H28N2O3S — CID 72890711
9-butan-2-ylsulfonyl-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one (PubChem CID 72890711) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is 9-butan-2-ylsulfonyl-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-butan-2-ylsulfonyl-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 72890711 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 9-butan-2-ylsulfonyl-2-prop-2-enyl-2,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=CCN1CC2(CCC1=O)CCN(S(=O)(=O)C(C)CC)CC2 |
| InChI | InChI=1S/C16H28N2O3S/c1-4-10-17-13-16(7-6-15(17)19)8-11-18(12-9-16)22(20,21)14(3)5-2/h4,14H,1,5-13H2,2-3H3 |
| InChIKey | UCJXGSOPKQOONU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|