C17H29N3O2 — CID 97121210
N-[(2R)-butan-2-yl]-3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecane-9-carboxamide (PubChem CID 97121210) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecane-9-carboxamide.
| Compound Name | N-[(2R)-butan-2-yl]-3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 97121210 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3-oxo-2-prop-2-enyl-2,9-diazaspiro[5.5]undecane-9-carboxamide |
| SMILES | C=CCN1CC2(CCC1=O)CCN(C(=O)N[C@H](C)CC)CC2 |
| InChI | InChI=1S/C17H29N3O2/c1-4-10-20-13-17(7-6-15(20)21)8-11-19(12-9-17)16(22)18-14(3)5-2/h4,14H,1,5-13H2,2-3H3,(H,18,22)/t14-/m1/s1 |
| InChIKey | JDOBKZUPDRMQNO-CQSZACIVSA-N |
| XLogP | 2.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|