C21H30N2O — CID 135094596
(4R,5R)-7-[(3,7-dimethyl-1H-indol-2-yl)methyl]-4-methoxy-7-azaspiro[4.5]decane (PubChem CID 135094596) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (4R,5R)-7-[(3,7-dimethyl-1H-indol-2-yl)methyl]-4-methoxy-7-azaspiro[4.5]decane.
| Compound Name | (4R,5R)-7-[(3,7-dimethyl-1H-indol-2-yl)methyl]-4-methoxy-7-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 135094596 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (4R,5R)-7-[(3,7-dimethyl-1H-indol-2-yl)methyl]-4-methoxy-7-azaspiro[4.5]decane |
| SMILES | CO[C@@H]1CCC[C@]12CCCN(Cc1[nH]c3c(C)cccc3c1C)C2 |
| InChI | InChI=1S/C21H30N2O/c1-15-7-4-8-17-16(2)18(22-20(15)17)13-23-12-6-11-21(14-23)10-5-9-19(21)24-3/h4,7-8,19,22H,5-6,9-14H2,1-3H3/t19-,21-/m1/s1 |
| InChIKey | FHYGSVQYAJULFM-TZIWHRDSSA-N |
| XLogP | 4.57 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|