C22H28N2O — CID 165427222
(4R,5R)-4-methoxy-7-[(4-pyridin-2-ylphenyl)methyl]-7-azaspiro[4.5]decane (PubChem CID 165427222) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (4R,5R)-4-methoxy-7-[(4-pyridin-2-ylphenyl)methyl]-7-azaspiro[4.5]decane.
| Compound Name | (4R,5R)-4-methoxy-7-[(4-pyridin-2-ylphenyl)methyl]-7-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 165427222 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (4R,5R)-4-methoxy-7-[(4-pyridin-2-ylphenyl)methyl]-7-azaspiro[4.5]decane |
| SMILES | CO[C@@H]1CCC[C@]12CCCN(Cc1ccc(-c3ccccn3)cc1)C2 |
| InChI | InChI=1S/C22H28N2O/c1-25-21-7-4-12-22(21)13-5-15-24(17-22)16-18-8-10-19(11-9-18)20-6-2-3-14-23-20/h2-3,6,8-11,14,21H,4-5,7,12-13,15-17H2,1H3/t21-,22-/m1/s1 |
| InChIKey | RLIWWBDXEGORAT-FGZHOGPDSA-N |
| XLogP | 4.53 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |