C15H22N2O — CID 135090113
(4R,5R)-4-methoxy-7-pyridin-2-yl-7-azaspiro[4.5]decane (PubChem CID 135090113) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is (4R,5R)-4-methoxy-7-pyridin-2-yl-7-azaspiro[4.5]decane.
| Compound Name | (4R,5R)-4-methoxy-7-pyridin-2-yl-7-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 135090113 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (4R,5R)-4-methoxy-7-pyridin-2-yl-7-azaspiro[4.5]decane |
| SMILES | CO[C@@H]1CCC[C@]12CCCN(c1ccccn1)C2 |
| InChI | InChI=1S/C15H22N2O/c1-18-13-6-4-8-15(13)9-5-11-17(12-15)14-7-2-3-10-16-14/h2-3,7,10,13H,4-6,8-9,11-12H2,1H3/t13-,15-/m1/s1 |
| InChIKey | RRBNTANQQMRLFE-UKRRQHHQSA-N |
| XLogP | 2.87 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |