C24H38N2O3 — CID 135096793
4-[3-[4-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]phenoxy]propyl]morpholine (PubChem CID 135096793) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-[3-[4-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]phenoxy]propyl]morpholine.
| Compound Name | 4-[3-[4-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]phenoxy]propyl]morpholine |
|---|---|
| PubChem CID | 135096793 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 4-[3-[4-[[(4R,5S)-4-methoxy-7-azaspiro[4.5]decan-7-yl]methyl]phenoxy]propyl]morpholine |
| SMILES | CO[C@@H]1CCC[C@@]12CCCN(Cc1ccc(OCCCN3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C24H38N2O3/c1-27-23-5-2-10-24(23)11-3-12-26(20-24)19-21-6-8-22(9-7-21)29-16-4-13-25-14-17-28-18-15-25/h6-9,23H,2-5,10-20H2,1H3/t23-,24+/m1/s1 |
| InChIKey | GJMQHTDAHVYDPX-RPWUZVMVSA-N |
| XLogP | 3.57 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|