C25H39N3O7 — CID 171317278
formic acid;9-methyl-1-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 171317278) has the molecular formula C25H39N3O7 and a molecular weight of 493.60 g/mol. Its IUPAC name is formic acid;9-methyl-1-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | formic acid;9-methyl-1-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 171317278 |
| Molecular Formula | C25H39N3O7 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | formic acid;9-methyl-1-[[4-(3-morpholin-4-ylpropoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | CN1CCCC2(CCCN2Cc2ccc(OCCCN3CCOCC3)cc2)C1=O.O=CO.O=CO |
| InChI | InChI=1S/C23H35N3O3.2CH2O2/c1-24-11-2-9-23(22(24)27)10-3-13-26(23)19-20-5-7-21(8-6-20)29-16-4-12-25-14-17-28-18-15-25;2*2-1-3/h5-8H,2-4,9-19H2,1H3;2*1H,(H,2,3) |
| InChIKey | USKPVHHKZJLMJV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|