C26H41N3O6 — CID 171317056
formic acid;1-[[4-(4-piperidin-1-ylbutoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 171317056) has the molecular formula C26H41N3O6 and a molecular weight of 491.63 g/mol. Its IUPAC name is formic acid;1-[[4-(4-piperidin-1-ylbutoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | formic acid;1-[[4-(4-piperidin-1-ylbutoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 171317056 |
| Molecular Formula | C26H41N3O6 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | formic acid;1-[[4-(4-piperidin-1-ylbutoxy)phenyl]methyl]-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | O=C1NCCCC12CCCN2Cc1ccc(OCCCCN2CCCCC2)cc1.O=CO.O=CO |
| InChI | InChI=1S/C24H37N3O2.2CH2O2/c28-23-24(12-6-14-25-23)13-7-18-27(24)20-21-8-10-22(11-9-21)29-19-5-4-17-26-15-2-1-3-16-26;2*2-1-3/h8-11H,1-7,12-20H2,(H,25,28);2*1H,(H,2,3) |
| InChIKey | FMTJWYPFGNDUTO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|