C17H21N3O — CID 135106529
4-[[cyclopropyl-[(2-ethylpyrimidin-5-yl)methyl]amino]methyl]phenol (PubChem CID 135106529) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-[[cyclopropyl-[(2-ethylpyrimidin-5-yl)methyl]amino]methyl]phenol.
| Compound Name | 4-[[cyclopropyl-[(2-ethylpyrimidin-5-yl)methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 135106529 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4-[[cyclopropyl-[(2-ethylpyrimidin-5-yl)methyl]amino]methyl]phenol |
| SMILES | CCc1ncc(CN(Cc2ccc(O)cc2)C2CC2)cn1 |
| InChI | InChI=1S/C17H21N3O/c1-2-17-18-9-14(10-19-17)12-20(15-5-6-15)11-13-3-7-16(21)8-4-13/h3-4,7-10,15,21H,2,5-6,11-12H2,1H3 |
| InChIKey | ZLNHHIHUYYYFML-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |