C13H16N4O3S2 — CID 135109147
4-(ethylsulfonylamino)-N-[(4-methylthiadiazol-5-yl)methyl]benzamide (PubChem CID 135109147) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-N-[(4-methylthiadiazol-5-yl)methyl]benzamide.
| Compound Name | 4-(ethylsulfonylamino)-N-[(4-methylthiadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135109147 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-(ethylsulfonylamino)-N-[(4-methylthiadiazol-5-yl)methyl]benzamide |
| SMILES | CCS(=O)(=O)Nc1ccc(C(=O)NCc2snnc2C)cc1 |
| InChI | InChI=1S/C13H16N4O3S2/c1-3-22(19,20)16-11-6-4-10(5-7-11)13(18)14-8-12-9(2)15-17-21-12/h4-7,16H,3,8H2,1-2H3,(H,14,18) |
| InChIKey | NLTZSHLXEKGYFB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |