C18H21N5O3S — CID 110122876
4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]-N-[(4-methylthiadiazol-5-yl)methyl]benzamide (PubChem CID 110122876) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]-N-[(4-methylthiadiazol-5-yl)methyl]benzamide.
| Compound Name | 4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]-N-[(4-methylthiadiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110122876 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]-N-[(4-methylthiadiazol-5-yl)methyl]benzamide |
| SMILES | Cc1nnsc1CNC(=O)c1ccc([C@@H]2NC(=O)N[C@H]3OCCC[C@H]32)cc1 |
| InChI | InChI=1S/C18H21N5O3S/c1-10-14(27-23-22-10)9-19-16(24)12-6-4-11(5-7-12)15-13-3-2-8-26-17(13)21-18(25)20-15/h4-7,13,15,17H,2-3,8-9H2,1H3,(H,19,24)(H2,20,21,25)/t13-,15-,17-/m0/s1 |
| InChIKey | ZFFYRQFYNBTEKT-QRTARXTBSA-N |
| XLogP | 1.88 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |