C23H28N4O4 — CID 110122829
N-[[3-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,4,6-trimethyl-2-oxopyridine-3-carboxamide (PubChem CID 110122829) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[[3-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,4,6-trimethyl-2-oxopyridine-3-carboxamide.
| Compound Name | N-[[3-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,4,6-trimethyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110122829 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[[3-[(4R,4aS,8aS)-2-oxo-1,3,4,4a,5,6,7,8a-octahydropyrano[2,3-d]pyrimidin-4-yl]phenyl]methyl]-1,4,6-trimethyl-2-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)NCc1cccc([C@@H]2NC(=O)N[C@H]3OCCC[C@H]32)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-13-10-14(2)27(3)22(29)18(13)20(28)24-12-15-6-4-7-16(11-15)19-17-8-5-9-31-21(17)26-23(30)25-19/h4,6-7,10-11,17,19,21H,5,8-9,12H2,1-3H3,(H,24,28)(H2,25,26,30)/t17-,19-,21-/m0/s1 |
| InChIKey | CPGVFUWJXDXEJY-CUWPLCDZSA-N |
| XLogP | 2.04 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |