C21H29N7O — CID 135110175
(4aR,6R,7aR)-6-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one (PubChem CID 135110175) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is (4aR,6R,7aR)-6-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one.
| Compound Name | (4aR,6R,7aR)-6-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 135110175 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | (4aR,6R,7aR)-6-[[4-amino-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl-methylamino]-2-methyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyridin-3-one |
| SMILES | Cc1cccc(Nc2nc(N)nc(CN(C)[C@@H]3C[C@@H]4CC(=O)N(C)C[C@@H]4C3)n2)c1 |
| InChI | InChI=1S/C21H29N7O/c1-13-5-4-6-16(7-13)23-21-25-18(24-20(22)26-21)12-27(2)17-8-14-10-19(29)28(3)11-15(14)9-17/h4-7,14-15,17H,8-12H2,1-3H3,(H3,22,23,24,25,26)/t14-,15+,17-/m1/s1 |
| InChIKey | UZQZQTMUOKGQHD-HLLBOEOZSA-N |
| XLogP | 2.19 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |