C18H24N8O — CID 134696973
2-N-(3-methylphenyl)-6-[[methyl-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 134696973) has the molecular formula C18H24N8O and a molecular weight of 368.45 g/mol. Its IUPAC name is 2-N-(3-methylphenyl)-6-[[methyl-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-methylphenyl)-6-[[methyl-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134696973 |
| Molecular Formula | C18H24N8O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 2-N-(3-methylphenyl)-6-[[methyl-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cccc(Nc2nc(N)nc(CN(C)Cc3nc(C(C)C)no3)n2)c1 |
| InChI | InChI=1S/C18H24N8O/c1-11(2)16-23-15(27-25-16)10-26(4)9-14-21-17(19)24-18(22-14)20-13-7-5-6-12(3)8-13/h5-8,11H,9-10H2,1-4H3,(H3,19,20,21,22,24) |
| InChIKey | AJJNGXWJJMBLAL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |