C38H41N13 — CID 157122704
3-[[4-amino-6-[[benzyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]benzonitrile;6-[[benzyl(methyl)amino]methyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 157122704) has the molecular formula C38H41N13 and a molecular weight of 679.84 g/mol. Its IUPAC name is 3-[[4-amino-6-[[benzyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]benzonitrile;6-[[benzyl(methyl)amino]methyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 3-[[4-amino-6-[[benzyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]benzonitrile;6-[[benzyl(methyl)amino]methyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157122704 |
| Molecular Formula | C38H41N13 |
| Molecular Weight | 679.84 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | 3-[[4-amino-6-[[benzyl(methyl)amino]methyl]-1,3,5-triazin-2-yl]amino]benzonitrile;6-[[benzyl(methyl)amino]methyl]-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(Cc1ccccc1)Cc1nc(N)nc(Nc2cccc(C#N)c2)n1.Cc1ccc(Nc2nc(N)nc(CN(C)Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H19N7.C19H22N6/c1-26(12-14-6-3-2-4-7-14)13-17-23-18(21)25-19(24-17)22-16-9-5-8-15(10-16)11-20;1-14-8-10-16(11-9-14)21-19-23-17(22-18(20)24-19)13-25(2)12-15-6-4-3-5-7-15/h2-10H,12-13H2,1H3,(H3,21,22,23,24,25);3-11H,12-13H2,1-2H3,(H3,20,21,22,23,24) |
| InChIKey | AIDVEEQGWCQOLG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 183.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.84 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |