C20H18N6O2 — CID 8003590
(4-cyanophenyl)methyl 3-(4-amino-6-anilino-1,3,5-triazin-2-yl)propanoate (PubChem CID 8003590) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 3-(4-amino-6-anilino-1,3,5-triazin-2-yl)propanoate.
| Compound Name | (4-cyanophenyl)methyl 3-(4-amino-6-anilino-1,3,5-triazin-2-yl)propanoate |
|---|---|
| PubChem CID | 8003590 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (4-cyanophenyl)methyl 3-(4-amino-6-anilino-1,3,5-triazin-2-yl)propanoate |
| SMILES | N#Cc1ccc(COC(=O)CCc2nc(N)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H18N6O2/c21-12-14-6-8-15(9-7-14)13-28-18(27)11-10-17-24-19(22)26-20(25-17)23-16-4-2-1-3-5-16/h1-9H,10-11,13H2,(H3,22,23,24,25,26) |
| InChIKey | LJOJLDOAPQKRQY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |