C19H26N8 — CID 134708244
2-N-(3-methylphenyl)-6-[[methyl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 134708244) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-N-(3-methylphenyl)-6-[[methyl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-methylphenyl)-6-[[methyl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 134708244 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-N-(3-methylphenyl)-6-[[methyl-[(1,3,5-trimethylpyrazol-4-yl)methyl]amino]methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cccc(Nc2nc(N)nc(CN(C)Cc3c(C)nn(C)c3C)n2)c1 |
| InChI | InChI=1S/C19H26N8/c1-12-7-6-8-15(9-12)21-19-23-17(22-18(20)24-19)11-26(4)10-16-13(2)25-27(5)14(16)3/h6-9H,10-11H2,1-5H3,(H3,20,21,22,23,24) |
| InChIKey | REOKFJZEEHAVTN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |