C24H31NO2 — CID 135113635
(3aR,6aS)-5-[methyl-[[4-(2-phenylethoxy)phenyl]methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol (PubChem CID 135113635) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (3aR,6aS)-5-[methyl-[[4-(2-phenylethoxy)phenyl]methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol.
| Compound Name | (3aR,6aS)-5-[methyl-[[4-(2-phenylethoxy)phenyl]methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
|---|---|
| PubChem CID | 135113635 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (3aR,6aS)-5-[methyl-[[4-(2-phenylethoxy)phenyl]methyl]amino]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-ol |
| SMILES | CN(Cc1ccc(OCCc2ccccc2)cc1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C24H31NO2/c1-25(22-13-20-15-23(26)16-21(20)14-22)17-19-7-9-24(10-8-19)27-12-11-18-5-3-2-4-6-18/h2-10,20-23,26H,11-17H2,1H3/t20-,21+,22?,23? |
| InChIKey | HRSSYQKDWSVSDZ-OIRDZHBESA-N |
| XLogP | 4.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |